30 July 2014
The fossil fuels were active
biology in prehistory. Now as they are
burned they are converted back into biomass by global photosynthesis! And most and land and sea area of the earth
is unconstrained nature.
Harvard University put on record
August 2010, average global carbon dioxide levels were Prix industrial levels
(two parts per million).
It is worth noting the carbon
dioxide levels in the Permian were five times higher! And we have 1000 year ice age. Then photosynthesis evolved, and carbon
dioxide levels crash to only one part per million. And 90% of life on earth died. The biggest mass extinction in earth history.
Carbon dioxide levels can only
rise in a natural ice age. During a warm
interglacial periods photosynthesis limits them-in the modern epoch to only two
parts per million.
A static trace gas affects
nothing! Critically not the most dynamic
system on earth. Solar cycles control
the Earth’s climate. Man has no control
over the carbon cycle.
Yet the EU subjects European
companies to a carbon tax! Where they
back calculate the carbon dioxide emissions of a company.
They cannot measure it! As plants suck carbon dioxide back to the
air. Down to the static level of
power! EU laws prevent the discriminatory
tax in favour of a toxic industry.
I nuclear fission from uranium
is the most toxic industry that will ever exist on earth. Causing intermittent toxic death across
continents. And stockpiling waste which
remains lethal for 100,000 years.
Nuclear power never costs the
storage of its waste for that time. As
it is 200 times the cost of operating a plant!
Carbon emissions increase life
on earth: so the carbon tax is actually a tax on life. In favour of the most toxic industry that
will ever exist.
So the carbon tax is illegal
under EU law. So its own lawmakers have
a legal duty to prohibits such taxation.
Its own tax is illegal!
So had he gets at energy? Copy nature.
It does massive amounts of molecular nuclear fusion.
1 mCO2+(n+p)(H2O+O2)->Cm(H2O)n+p(He2++O32-+gwr+E2)
So photosynthesis is one type of
biological molecular nuclear fusion.
2 Cm(H2O)n+mO2->pCO2+(n-p)H2O+p(E2+O3+gwr)
So animal life is also dependent
on the energy from nuclear fusion. It
converts the waste gas of plants (O2) back into planned food(CO2). The gas the EU wants to tax. Demonstrating a total lack of appreciation of
biology.
If large carbon dioxide
producers like Drax power station wish to challenge the carbon tax-it is an
open and shut case! It breaches basic
European anti competition laws. The EU
prohibits favouring toxic industries.
As any gardener will tell you,
it’s a carbon dioxide translates into extra plant and animal life. It is not hard! More uranium nuclear fission leads inevitably
to more global death.
But nature does nuclear
fusion. From molecular hydrogen-usually
water.
3 H2O+Tc->He2++O2-+E3+gwr gwr= high frequency X rays
Every biological organism on
earth does it. Via the turbulent flow of
water, Allied to catalists. Your own
beating heart does it! Plant photo
blasts do it! Which is why all
biological life is gamma wave radiation and produces helium and ozone gases.
Every year 1040 Watts
of energy is for it nature from this source.
Only 1060 comes from direct sun light.
The most engineering useful type
is via lightning! They chaotic
interaction of heavy rain drops does 3.
The Alpha particles collect above the clouds. The negative charge falls to the ground. When we have a potential of 5000 volts 100
amps a partial steam plasma links up electron holes between the clouds and the
ground.
This produces 5 tonnes of helium
gas. Which translates to a release of
2.5x1030 Watts of power. As
heat, sound, light and nuclear radiation.
There is no chemical source of light, nuclear radiation or helium.
It is nature doing molecular
nuclear fusion. Which translates into
5.8W/m. With no carbon dioxide! And no toxic radioactive waste.
They 3helium produced
is lost to space within 24 hours. Having
reacted with nothing! Totally
transparent to biology. Which relies on
the energy released by molecular nuclear fusion.
There is no reason why we can’t
replace or eight rows of gas or oil burners with a single steam plasma tube.
That takes 2000 volts to
initialise! Above four atmospheres he
runs unpowered. While we top up the
steam pressure with regular water. It
enrich its own isotope numbers. Causing
the atoms to fission into heat, light and nuclear radiation.
The hydrogen ions combine with
free electrons to form neutrons. It is
these neutrons the bond with other hydrogen and oxygen ions, making radioactive
then fission into lower atomic numbers.
In the and converting all the
matter into heat, light and nuclear radiation.
As I mentioned above, this process goes on in a beating hearts! So we are talking about low power harmless
nuclear radiation.
You can take your poles with a
Geiger counter! If you need
confirmation. Or go for a walk in the
fields full grants during the day.
Plants give off nuclear radiation!
The whole natural world gives
off nuclear radiation. Venting steam
medically through high pressure water does molecular nuclear fusion.
Which is why hot smokers support
massive ecosystems away from direct sun light.
They generate their own light!
The only possible from nuclear reaction.
No source of nuclear fission.
So we are doing the nuclear
fusion from their hydrogen ions in molecules.
Everywhere you look nature is doing molecular nuclear fusion. For free!
Molecular nuclear fusion is four
times as exothermic as hyper toxic nuclear fission from uranium: the technology
of hades! Which should be globally
prohibited. Or it will kill off all of
mankind!
Molecular nuclear fusion from
steam is a most exothermic process that happens around the earth. Hydrogen fission via a glass tube filled with
hydrogen gas is twice as exothermic.
Converts the matter into light,
heat and low power nuclear radiation. So
it is worthwhile doing the electrolysis of water. And discarding the oxygen! Just feeding the hydrogen into a gas plasma.
We so do not need the hyper
toxic energy from present nuclear power.
Molecular nuclear fusion has a major role in supporting more life on
earth.
Nuclear fission from uranium
kills all life on earth. If we don’t
stop it-presumably it will kill you soon.